C36H50N4O6 — CID 21341214
2-cyclohexyl-2-[3-[[4-[2-(4-nitrophenyl)ethoxycarbonyl-propylamino]piperidin-1-yl]methyl]-4-phenylpyrrolidin-1-yl]acetic acid (PubChem CID 21341214) has the molecular formula C36H50N4O6 and a molecular weight of 634.82 g/mol. Its IUPAC name is 2-cyclohexyl-2-[3-[[4-[2-(4-nitrophenyl)ethoxycarbonyl-propylamino]piperidin-1-yl]methyl]-4-phenylpyrrolidin-1-yl]acetic acid.
| Compound Name | 2-cyclohexyl-2-[3-[[4-[2-(4-nitrophenyl)ethoxycarbonyl-propylamino]piperidin-1-yl]methyl]-4-phenylpyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 21341214 |
| Molecular Formula | C36H50N4O6 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.37 |
| IUPAC Name | 2-cyclohexyl-2-[3-[[4-[2-(4-nitrophenyl)ethoxycarbonyl-propylamino]piperidin-1-yl]methyl]-4-phenylpyrrolidin-1-yl]acetic acid |
| SMILES | CCCN(C(=O)OCCc1ccc([N+](=O)[O-])cc1)C1CCN(CC2CN(C(C(=O)O)C3CCCCC3)CC2c2ccccc2)CC1 |
| InChI | InChI=1S/C36H50N4O6/c1-2-20-39(36(43)46-23-19-27-13-15-32(16-14-27)40(44)45)31-17-21-37(22-18-31)24-30-25-38(26-33(30)28-9-5-3-6-10-28)34(35(41)42)29-11-7-4-8-12-29/h3,5-6,9-10,13-16,29-31,33-34H,2,4,7-8,11-12,17-26H2,1H3,(H,41,42) |
| InChIKey | WURZLBYSMXQELE-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|