C37H50N4O5 — CID 159126666
(2R)-2-cyclohexyl-2-[(3S,4S)-3-[[4-[cyclopropylmethyl-[3-(4-nitrophenyl)propanoyl]amino]piperidin-1-yl]methyl]-4-phenylpyrrolidin-1-yl]acetic acid (PubChem CID 159126666) has the molecular formula C37H50N4O5 and a molecular weight of 630.83 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-2-[(3S,4S)-3-[[4-[cyclopropylmethyl-[3-(4-nitrophenyl)propanoyl]amino]piperidin-1-yl]methyl]-4-phenylpyrrolidin-1-yl]acetic acid.
| Compound Name | (2R)-2-cyclohexyl-2-[(3S,4S)-3-[[4-[cyclopropylmethyl-[3-(4-nitrophenyl)propanoyl]amino]piperidin-1-yl]methyl]-4-phenylpyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 159126666 |
| Molecular Formula | C37H50N4O5 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.38 |
| IUPAC Name | (2R)-2-cyclohexyl-2-[(3S,4S)-3-[[4-[cyclopropylmethyl-[3-(4-nitrophenyl)propanoyl]amino]piperidin-1-yl]methyl]-4-phenylpyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)[C@@H](C1CCCCC1)N1C[C@H](CN2CCC(N(CC3CC3)C(=O)CCc3ccc([N+](=O)[O-])cc3)CC2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C37H50N4O5/c42-35(18-15-27-13-16-33(17-14-27)41(45)46)40(23-28-11-12-28)32-19-21-38(22-20-32)24-31-25-39(26-34(31)29-7-3-1-4-8-29)36(37(43)44)30-9-5-2-6-10-30/h1,3-4,7-8,13-14,16-17,28,30-32,34,36H,2,5-6,9-12,15,18-26H2,(H,43,44)/t31-,34+,36+/m0/s1 |
| InChIKey | ASLUWGZTOADNFC-FFPQSLRISA-N |
| XLogP | 5.98 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|