C40H51N3O2S — CID 142033660
benzene;benzyl N-ethyl-N-[1-[[3-[methyl(2-naphthalen-1-ylethylsulfanyl)amino]cyclopentyl]methyl]piperidin-4-yl]carbamate (PubChem CID 142033660) has the molecular formula C40H51N3O2S and a molecular weight of 637.93 g/mol. Its IUPAC name is benzene;benzyl N-ethyl-N-[1-[[3-[methyl(2-naphthalen-1-ylethylsulfanyl)amino]cyclopentyl]methyl]piperidin-4-yl]carbamate.
| Compound Name | benzene;benzyl N-ethyl-N-[1-[[3-[methyl(2-naphthalen-1-ylethylsulfanyl)amino]cyclopentyl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142033660 |
| Molecular Formula | C40H51N3O2S |
| Molecular Weight | 637.93 g/mol |
| Exact Mass | 637.37 |
| IUPAC Name | benzene;benzyl N-ethyl-N-[1-[[3-[methyl(2-naphthalen-1-ylethylsulfanyl)amino]cyclopentyl]methyl]piperidin-4-yl]carbamate |
| SMILES | CCN(C(=O)OCc1ccccc1)C1CCN(CC2CCC(N(C)SCCc3cccc4ccccc34)C2)CC1.c1ccccc1 |
| InChI | InChI=1S/C34H45N3O2S.C6H6/c1-3-37(34(38)39-26-27-10-5-4-6-11-27)31-18-21-36(22-19-31)25-28-16-17-32(24-28)35(2)40-23-20-30-14-9-13-29-12-7-8-15-33(29)30;1-2-4-6-5-3-1/h4-15,28,31-32H,3,16-26H2,1-2H3;1-6H |
| InChIKey | SMSMXYDPHPRDDM-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.93 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|