C23H36N2O2 — CID 153052530
2-[methyl-[(3R)-3-[[4-(3-phenylpropyl)piperidin-1-yl]methyl]cyclopentyl]amino]acetic acid (PubChem CID 153052530) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is 2-[methyl-[(3R)-3-[[4-(3-phenylpropyl)piperidin-1-yl]methyl]cyclopentyl]amino]acetic acid.
| Compound Name | 2-[methyl-[(3R)-3-[[4-(3-phenylpropyl)piperidin-1-yl]methyl]cyclopentyl]amino]acetic acid |
|---|---|
| PubChem CID | 153052530 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | 2-[methyl-[(3R)-3-[[4-(3-phenylpropyl)piperidin-1-yl]methyl]cyclopentyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C1CC[C@@H](CN2CCC(CCCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C23H36N2O2/c1-24(18-23(26)27)22-11-10-21(16-22)17-25-14-12-20(13-15-25)9-5-8-19-6-3-2-4-7-19/h2-4,6-7,20-22H,5,8-18H2,1H3,(H,26,27)/t21-,22?/m1/s1 |
| InChIKey | VHVOGUYBCIZAEB-ZMFCMNQTSA-N |
| XLogP | 3.91 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |