C26H40N2O2 — CID 142032884
methyl N-cyclobutyl-N-[3-[[4-(3-phenylpropyl)piperidin-1-yl]methyl]cyclopentyl]carbamate (PubChem CID 142032884) has the molecular formula C26H40N2O2 and a molecular weight of 412.62 g/mol. Its IUPAC name is methyl N-cyclobutyl-N-[3-[[4-(3-phenylpropyl)piperidin-1-yl]methyl]cyclopentyl]carbamate.
| Compound Name | methyl N-cyclobutyl-N-[3-[[4-(3-phenylpropyl)piperidin-1-yl]methyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 142032884 |
| Molecular Formula | C26H40N2O2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | methyl N-cyclobutyl-N-[3-[[4-(3-phenylpropyl)piperidin-1-yl]methyl]cyclopentyl]carbamate |
| SMILES | COC(=O)N(C1CCC1)C1CCC(CN2CCC(CCCc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C26H40N2O2/c1-30-26(29)28(24-11-6-12-24)25-14-13-23(19-25)20-27-17-15-22(16-18-27)10-5-9-21-7-3-2-4-8-21/h2-4,7-8,22-25H,5-6,9-20H2,1H3 |
| InChIKey | GSMKRPXHLOCXBR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |