C32H45N5O5 — CID 142033172
benzene;1-ethyl-1-[1-[[3-[(5-methyl-2-oxooxolan-3-yl)amino]cyclopentyl]methyl]piperidin-4-yl]-3-[(4-nitrophenyl)methyl]urea (PubChem CID 142033172) has the molecular formula C32H45N5O5 and a molecular weight of 579.74 g/mol. Its IUPAC name is benzene;1-ethyl-1-[1-[[3-[(5-methyl-2-oxooxolan-3-yl)amino]cyclopentyl]methyl]piperidin-4-yl]-3-[(4-nitrophenyl)methyl]urea.
| Compound Name | benzene;1-ethyl-1-[1-[[3-[(5-methyl-2-oxooxolan-3-yl)amino]cyclopentyl]methyl]piperidin-4-yl]-3-[(4-nitrophenyl)methyl]urea |
|---|---|
| PubChem CID | 142033172 |
| Molecular Formula | C32H45N5O5 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.34 |
| IUPAC Name | benzene;1-ethyl-1-[1-[[3-[(5-methyl-2-oxooxolan-3-yl)amino]cyclopentyl]methyl]piperidin-4-yl]-3-[(4-nitrophenyl)methyl]urea |
| SMILES | CCN(C(=O)NCc1ccc([N+](=O)[O-])cc1)C1CCN(CC2CCC(NC3CC(C)OC3=O)C2)CC1.c1ccccc1 |
| InChI | InChI=1S/C26H39N5O5.C6H6/c1-3-30(26(33)27-16-19-5-8-23(9-6-19)31(34)35)22-10-12-29(13-11-22)17-20-4-7-21(15-20)28-24-14-18(2)36-25(24)32;1-2-4-6-5-3-1/h5-6,8-9,18,20-22,24,28H,3-4,7,10-17H2,1-2H3,(H,27,33);1-6H |
| InChIKey | NJJHFERHWLWWSV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|