C34H41N4O7S- — CID 57368565
N-[3-[1-[3-[[benzenesulfonyl(methyl)amino]methyl]-4-hydroxy-3-phenylbutyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate (PubChem CID 57368565) has the molecular formula C34H41N4O7S- and a molecular weight of 649.79 g/mol. Its IUPAC name is N-[3-[1-[3-[[benzenesulfonyl(methyl)amino]methyl]-4-hydroxy-3-phenylbutyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate.
| Compound Name | N-[3-[1-[3-[[benzenesulfonyl(methyl)amino]methyl]-4-hydroxy-3-phenylbutyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 57368565 |
| Molecular Formula | C34H41N4O7S- |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | N-[3-[1-[3-[[benzenesulfonyl(methyl)amino]methyl]-4-hydroxy-3-phenylbutyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate |
| SMILES | CN(CC(CO)(CCN1CCC(C=CCN(Cc2ccc([N+](=O)[O-])cc2)C(=O)[O-])CC1)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H42N4O7S/c1-35(46(44,45)32-12-6-3-7-13-32)26-34(27-39,30-10-4-2-5-11-30)20-24-36-22-18-28(19-23-36)9-8-21-37(33(40)41)25-29-14-16-31(17-15-29)38(42)43/h2-17,28,39H,18-27H2,1H3,(H,40,41)/p-1 |
| InChIKey | ZYNFCBXWCWSOEE-UHFFFAOYSA-M |
| XLogP | 3.65 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|