C34H40N3O6S- — CID 57371893
N-[3-[1-[(3R,5R)-5-(benzenesulfonyl)-3-phenylhexyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate (PubChem CID 57371893) has the molecular formula C34H40N3O6S- and a molecular weight of 618.78 g/mol. Its IUPAC name is N-[3-[1-[(3R,5R)-5-(benzenesulfonyl)-3-phenylhexyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate.
| Compound Name | N-[3-[1-[(3R,5R)-5-(benzenesulfonyl)-3-phenylhexyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 57371893 |
| Molecular Formula | C34H40N3O6S- |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.26 |
| IUPAC Name | N-[3-[1-[(3R,5R)-5-(benzenesulfonyl)-3-phenylhexyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate |
| SMILES | C[C@H](C[C@@H](CCN1CCC(C=CCN(Cc2ccc([N+](=O)[O-])cc2)C(=O)[O-])CC1)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H41N3O6S/c1-27(44(42,43)33-12-6-3-7-13-33)25-31(30-10-4-2-5-11-30)20-24-35-22-18-28(19-23-35)9-8-21-36(34(38)39)26-29-14-16-32(17-15-29)37(40)41/h2-17,27-28,31H,18-26H2,1H3,(H,38,39)/p-1/t27-,31-/m1/s1 |
| InChIKey | NWDWWRYJIHOVPD-DLFZDVPBSA-M |
| XLogP | 5.43 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|