C36H44N3O6S- — CID 57371899
N-[3-[1-[5-(benzenesulfonyl)-3,5-dimethyl-3-phenylhexyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate (PubChem CID 57371899) has the molecular formula C36H44N3O6S- and a molecular weight of 646.83 g/mol. Its IUPAC name is N-[3-[1-[5-(benzenesulfonyl)-3,5-dimethyl-3-phenylhexyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate.
| Compound Name | N-[3-[1-[5-(benzenesulfonyl)-3,5-dimethyl-3-phenylhexyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 57371899 |
| Molecular Formula | C36H44N3O6S- |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.30 |
| IUPAC Name | N-[3-[1-[5-(benzenesulfonyl)-3,5-dimethyl-3-phenylhexyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate |
| SMILES | CC(CCN1CCC(C=CCN(Cc2ccc([N+](=O)[O-])cc2)C(=O)[O-])CC1)(CC(C)(C)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H45N3O6S/c1-35(2,46(44,45)33-14-8-5-9-15-33)28-36(3,31-12-6-4-7-13-31)22-26-37-24-20-29(21-25-37)11-10-23-38(34(40)41)27-30-16-18-32(19-17-30)39(42)43/h4-19,29H,20-28H2,1-3H3,(H,40,41)/p-1 |
| InChIKey | VMOFWGTZFZXHRG-UHFFFAOYSA-M |
| XLogP | 6.00 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|