C35H40N5O4- — CID 57359266
N-[3-[1-[4-(2-ethylbenzimidazol-1-yl)-3-phenylbutyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate (PubChem CID 57359266) has the molecular formula C35H40N5O4- and a molecular weight of 594.74 g/mol. Its IUPAC name is N-[3-[1-[4-(2-ethylbenzimidazol-1-yl)-3-phenylbutyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate.
| Compound Name | N-[3-[1-[4-(2-ethylbenzimidazol-1-yl)-3-phenylbutyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 57359266 |
| Molecular Formula | C35H40N5O4- |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | N-[3-[1-[4-(2-ethylbenzimidazol-1-yl)-3-phenylbutyl]piperidin-4-yl]prop-2-enyl]-N-[(4-nitrophenyl)methyl]carbamate |
| SMILES | CCc1nc2ccccc2n1CC(CCN1CCC(C=CCN(Cc2ccc([N+](=O)[O-])cc2)C(=O)[O-])CC1)c1ccccc1 |
| InChI | InChI=1S/C35H41N5O4/c1-2-34-36-32-12-6-7-13-33(32)39(34)26-30(29-10-4-3-5-11-29)20-24-37-22-18-27(19-23-37)9-8-21-38(35(41)42)25-28-14-16-31(17-15-28)40(43)44/h3-17,27,30H,2,18-26H2,1H3,(H,41,42)/p-1 |
| InChIKey | MTGGWHSJOHTJQU-UHFFFAOYSA-M |
| XLogP | 5.79 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|