C36H45N3O6S — CID 57371900
3-[1-[5-(benzenesulfonyl)-3,5-dimethyl-3-phenylhexyl]piperidin-4-yl]prop-2-enyl-[(4-nitrophenyl)methyl]carbamic acid (PubChem CID 57371900) has the molecular formula C36H45N3O6S and a molecular weight of 647.84 g/mol. Its IUPAC name is 3-[1-[5-(benzenesulfonyl)-3,5-dimethyl-3-phenylhexyl]piperidin-4-yl]prop-2-enyl-[(4-nitrophenyl)methyl]carbamic acid.
| Compound Name | 3-[1-[5-(benzenesulfonyl)-3,5-dimethyl-3-phenylhexyl]piperidin-4-yl]prop-2-enyl-[(4-nitrophenyl)methyl]carbamic acid |
|---|---|
| PubChem CID | 57371900 |
| Molecular Formula | C36H45N3O6S |
| Molecular Weight | 647.84 g/mol |
| Exact Mass | 647.30 |
| IUPAC Name | 3-[1-[5-(benzenesulfonyl)-3,5-dimethyl-3-phenylhexyl]piperidin-4-yl]prop-2-enyl-[(4-nitrophenyl)methyl]carbamic acid |
| SMILES | CC(CCN1CCC(C=CCN(Cc2ccc([N+](=O)[O-])cc2)C(=O)O)CC1)(CC(C)(C)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H45N3O6S/c1-35(2,46(44,45)33-14-8-5-9-15-33)28-36(3,31-12-6-4-7-13-31)22-26-37-24-20-29(21-25-37)11-10-23-38(34(40)41)27-30-16-18-32(19-17-30)39(42)43/h4-19,29H,20-28H2,1-3H3,(H,40,41) |
| InChIKey | VMOFWGTZFZXHRG-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.84 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|