C34H43N3O4S — CID 70153397
benzyl 4-[[1-[4-[benzenesulfonyl(methyl)amino]-3-methyl-3-phenylbutyl]piperidin-4-yl]amino]but-2-enoate (PubChem CID 70153397) has the molecular formula C34H43N3O4S and a molecular weight of 589.80 g/mol. Its IUPAC name is benzyl 4-[[1-[4-[benzenesulfonyl(methyl)amino]-3-methyl-3-phenylbutyl]piperidin-4-yl]amino]but-2-enoate.
| Compound Name | benzyl 4-[[1-[4-[benzenesulfonyl(methyl)amino]-3-methyl-3-phenylbutyl]piperidin-4-yl]amino]but-2-enoate |
|---|---|
| PubChem CID | 70153397 |
| Molecular Formula | C34H43N3O4S |
| Molecular Weight | 589.80 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | benzyl 4-[[1-[4-[benzenesulfonyl(methyl)amino]-3-methyl-3-phenylbutyl]piperidin-4-yl]amino]but-2-enoate |
| SMILES | CN(CC(C)(CCN1CCC(NCC=CC(=O)OCc2ccccc2)CC1)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H43N3O4S/c1-34(30-15-8-4-9-16-30,28-36(2)42(39,40)32-17-10-5-11-18-32)22-26-37-24-20-31(21-25-37)35-23-12-19-33(38)41-27-29-13-6-3-7-14-29/h3-19,31,35H,20-28H2,1-2H3 |
| InChIKey | BRAANDOTIVTNFO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.80 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|