C33H48N2O4S — CID 158513943
tert-butyl 3-[4-[[4-(1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-yl)-2-methyl-2-phenylbutyl]-methylsulfamoyl]phenyl]propanoate (PubChem CID 158513943) has the molecular formula C33H48N2O4S and a molecular weight of 568.82 g/mol. Its IUPAC name is tert-butyl 3-[4-[[4-(1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-yl)-2-methyl-2-phenylbutyl]-methylsulfamoyl]phenyl]propanoate.
| Compound Name | tert-butyl 3-[4-[[4-(1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-yl)-2-methyl-2-phenylbutyl]-methylsulfamoyl]phenyl]propanoate |
|---|---|
| PubChem CID | 158513943 |
| Molecular Formula | C33H48N2O4S |
| Molecular Weight | 568.82 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | tert-butyl 3-[4-[[4-(1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-yl)-2-methyl-2-phenylbutyl]-methylsulfamoyl]phenyl]propanoate |
| SMILES | CN(CC(C)(CCN1CCC2CCCC2C1)c1ccccc1)S(=O)(=O)c1ccc(CCC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C33H48N2O4S/c1-32(2,3)39-31(36)19-16-26-14-17-30(18-15-26)40(37,38)34(5)25-33(4,29-12-7-6-8-13-29)21-23-35-22-20-27-10-9-11-28(27)24-35/h6-8,12-15,17-18,27-28H,9-11,16,19-25H2,1-5H3 |
| InChIKey | HLJZXSCNXBGOMQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.82 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |