C15H20N2O5S — CID 167782696
3-[4-[methyl-(1-methyl-2-oxopyrrolidin-3-yl)sulfamoyl]phenyl]propanoic acid (PubChem CID 167782696) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-[4-[methyl-(1-methyl-2-oxopyrrolidin-3-yl)sulfamoyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[methyl-(1-methyl-2-oxopyrrolidin-3-yl)sulfamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 167782696 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-[4-[methyl-(1-methyl-2-oxopyrrolidin-3-yl)sulfamoyl]phenyl]propanoic acid |
| SMILES | CN1CCC(N(C)S(=O)(=O)c2ccc(CCC(=O)O)cc2)C1=O |
| InChI | InChI=1S/C15H20N2O5S/c1-16-10-9-13(15(16)20)17(2)23(21,22)12-6-3-11(4-7-12)5-8-14(18)19/h3-4,6-7,13H,5,8-10H2,1-2H3,(H,18,19) |
| InChIKey | HRLKCHQERAAMSV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |