C29H33Cl2N5O4 — CID 57371924
3-[1-[4-(4,5-dichloroimidazol-1-yl)-3-phenylbutyl]piperidin-4-yl]prop-2-enyl-[(4-nitrophenyl)methyl]carbamic acid (PubChem CID 57371924) has the molecular formula C29H33Cl2N5O4 and a molecular weight of 586.52 g/mol. Its IUPAC name is 3-[1-[4-(4,5-dichloroimidazol-1-yl)-3-phenylbutyl]piperidin-4-yl]prop-2-enyl-[(4-nitrophenyl)methyl]carbamic acid.
| Compound Name | 3-[1-[4-(4,5-dichloroimidazol-1-yl)-3-phenylbutyl]piperidin-4-yl]prop-2-enyl-[(4-nitrophenyl)methyl]carbamic acid |
|---|---|
| PubChem CID | 57371924 |
| Molecular Formula | C29H33Cl2N5O4 |
| Molecular Weight | 586.52 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | 3-[1-[4-(4,5-dichloroimidazol-1-yl)-3-phenylbutyl]piperidin-4-yl]prop-2-enyl-[(4-nitrophenyl)methyl]carbamic acid |
| SMILES | O=C(O)N(CC=CC1CCN(CCC(Cn2cnc(Cl)c2Cl)c2ccccc2)CC1)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H33Cl2N5O4/c30-27-28(31)35(21-32-27)20-25(24-6-2-1-3-7-24)14-18-33-16-12-22(13-17-33)5-4-15-34(29(37)38)19-23-8-10-26(11-9-23)36(39)40/h1-11,21-22,25H,12-20H2,(H,37,38) |
| InChIKey | FIJWIFFWXNDHAC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.52 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|