C34H44N2O3 — CID 3010255
benzyl N-ethyl-N-[1-(3-phenyl-5-phenylmethoxyhexyl)piperidin-4-yl]carbamate (PubChem CID 3010255) has the molecular formula C34H44N2O3 and a molecular weight of 528.74 g/mol. Its IUPAC name is benzyl N-ethyl-N-[1-(3-phenyl-5-phenylmethoxyhexyl)piperidin-4-yl]carbamate.
| Compound Name | benzyl N-ethyl-N-[1-(3-phenyl-5-phenylmethoxyhexyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 3010255 |
| Molecular Formula | C34H44N2O3 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.34 |
| IUPAC Name | benzyl N-ethyl-N-[1-(3-phenyl-5-phenylmethoxyhexyl)piperidin-4-yl]carbamate |
| SMILES | CCN(C(=O)OCc1ccccc1)C1CCN(CCC(CC(C)OCc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C34H44N2O3/c1-3-36(34(37)39-27-30-15-9-5-10-16-30)33-20-23-35(24-21-33)22-19-32(31-17-11-6-12-18-31)25-28(2)38-26-29-13-7-4-8-14-29/h4-18,28,32-33H,3,19-27H2,1-2H3 |
| InChIKey | DXVIZQRYEHUENT-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |