C15H17N3O4S2 — CID 24684878
N-methyl-N-[2-(methylamino)-2-oxoethyl]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 24684878) has the molecular formula C15H17N3O4S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-methyl-N-[2-(methylamino)-2-oxoethyl]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-methyl-N-[2-(methylamino)-2-oxoethyl]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 24684878 |
| Molecular Formula | C15H17N3O4S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-methyl-N-[2-(methylamino)-2-oxoethyl]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CNC(=O)CN(C)C(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H17N3O4S2/c1-16-13(19)10-18(2)15(20)11-6-3-4-7-12(11)17-24(21,22)14-8-5-9-23-14/h3-9,17H,10H2,1-2H3,(H,16,19) |
| InChIKey | MPXXVFXKPKRWOL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |