C13H16O11S — CID 130302786
benzenesulfonic acid;butanedioic acid;propanedioic acid (PubChem CID 130302786) has the molecular formula C13H16O11S and a molecular weight of 380.33 g/mol. Its IUPAC name is benzenesulfonic acid;butanedioic acid;propanedioic acid.
| Compound Name | benzenesulfonic acid;butanedioic acid;propanedioic acid |
|---|---|
| PubChem CID | 130302786 |
| Molecular Formula | C13H16O11S |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | benzenesulfonic acid;butanedioic acid;propanedioic acid |
| SMILES | O=C(O)CC(=O)O.O=C(O)CCC(=O)O.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C6H6O3S.C4H6O4.C3H4O4/c7-10(8,9)6-4-2-1-3-5-6;5-3(6)1-2-4(7)8;4-2(5)1-3(6)7/h1-5H,(H,7,8,9);1-2H2,(H,5,6)(H,7,8);1H2,(H,4,5)(H,6,7) |
| InChIKey | YHZVQKHETDOXPM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 203.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|