C23H21NO3S — CID 164665573
(E)-3-(2-methylphenyl)-N-(4-methylphenyl)sulfonyl-2-phenylprop-2-enamide (PubChem CID 164665573) has the molecular formula C23H21NO3S and a molecular weight of 391.49 g/mol. Its IUPAC name is (E)-3-(2-methylphenyl)-N-(4-methylphenyl)sulfonyl-2-phenylprop-2-enamide.
| Compound Name | (E)-3-(2-methylphenyl)-N-(4-methylphenyl)sulfonyl-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 164665573 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (E)-3-(2-methylphenyl)-N-(4-methylphenyl)sulfonyl-2-phenylprop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)/C(=C/c2ccccc2C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO3S/c1-17-12-14-21(15-13-17)28(26,27)24-23(25)22(19-9-4-3-5-10-19)16-20-11-7-6-8-18(20)2/h3-16H,1-2H3,(H,24,25)/b22-16+ |
| InChIKey | NHMGNZIEQHBOGS-CJLVFECKSA-N |
| XLogP | 4.35 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|