C22H19NO5S — CID 91585974
N-[1-(3,4-dihydroxyphenyl)-3-oxo-3-phenylprop-1-en-2-yl]-4-methylbenzenesulfonamide (PubChem CID 91585974) has the molecular formula C22H19NO5S and a molecular weight of 409.46 g/mol. Its IUPAC name is N-[1-(3,4-dihydroxyphenyl)-3-oxo-3-phenylprop-1-en-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-(3,4-dihydroxyphenyl)-3-oxo-3-phenylprop-1-en-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 91585974 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-[1-(3,4-dihydroxyphenyl)-3-oxo-3-phenylprop-1-en-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=Cc2ccc(O)c(O)c2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19NO5S/c1-15-7-10-18(11-8-15)29(27,28)23-19(22(26)17-5-3-2-4-6-17)13-16-9-12-20(24)21(25)14-16/h2-14,23-25H,1H3 |
| InChIKey | RBVXDFZETDRZPU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|