C25H33NO4SSi — CID 138965228
(Z)-6-[tert-butyl(dimethyl)silyl]-N-(4-methylphenyl)sulfonyl-6-oxo-2-phenylhex-2-enamide (PubChem CID 138965228) has the molecular formula C25H33NO4SSi and a molecular weight of 471.70 g/mol. Its IUPAC name is (Z)-6-[tert-butyl(dimethyl)silyl]-N-(4-methylphenyl)sulfonyl-6-oxo-2-phenylhex-2-enamide.
| Compound Name | (Z)-6-[tert-butyl(dimethyl)silyl]-N-(4-methylphenyl)sulfonyl-6-oxo-2-phenylhex-2-enamide |
|---|---|
| PubChem CID | 138965228 |
| Molecular Formula | C25H33NO4SSi |
| Molecular Weight | 471.70 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (Z)-6-[tert-butyl(dimethyl)silyl]-N-(4-methylphenyl)sulfonyl-6-oxo-2-phenylhex-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)/C(=C\CCC(=O)[Si](C)(C)C(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H33NO4SSi/c1-19-15-17-21(18-16-19)31(29,30)26-24(28)22(20-11-8-7-9-12-20)13-10-14-23(27)32(5,6)25(2,3)4/h7-9,11-13,15-18H,10,14H2,1-6H3,(H,26,28)/b22-13- |
| InChIKey | NAKOHCYOMQDIIO-XKZIYDEJSA-N |
| XLogP | 5.28 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.70 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|