C14H16F3NO3S — CID 102369559
(2Z)-N-(4-methylphenyl)sulfonyl-2-(2,2,2-trifluoroethylidene)pentanamide (PubChem CID 102369559) has the molecular formula C14H16F3NO3S and a molecular weight of 335.35 g/mol. Its IUPAC name is (2Z)-N-(4-methylphenyl)sulfonyl-2-(2,2,2-trifluoroethylidene)pentanamide.
| Compound Name | (2Z)-N-(4-methylphenyl)sulfonyl-2-(2,2,2-trifluoroethylidene)pentanamide |
|---|---|
| PubChem CID | 102369559 |
| Molecular Formula | C14H16F3NO3S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (2Z)-N-(4-methylphenyl)sulfonyl-2-(2,2,2-trifluoroethylidene)pentanamide |
| SMILES | CCC/C(=C/C(F)(F)F)C(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H16F3NO3S/c1-3-4-11(9-14(15,16)17)13(19)18-22(20,21)12-7-5-10(2)6-8-12/h5-9H,3-4H2,1-2H3,(H,18,19)/b11-9- |
| InChIKey | KXWIWTHGKUXBRV-LUAWRHEFSA-N |
| XLogP | 3.09 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|