C12H11F3N2O4S — CID 177477922
(E)-4,4,4-trifluoro-3-hydroxy-2-methanimidoyl-N-(4-methylphenyl)sulfonylbut-2-enamide (PubChem CID 177477922) has the molecular formula C12H11F3N2O4S and a molecular weight of 336.29 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-hydroxy-2-methanimidoyl-N-(4-methylphenyl)sulfonylbut-2-enamide.
| Compound Name | (E)-4,4,4-trifluoro-3-hydroxy-2-methanimidoyl-N-(4-methylphenyl)sulfonylbut-2-enamide |
|---|---|
| PubChem CID | 177477922 |
| Molecular Formula | C12H11F3N2O4S |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-hydroxy-2-methanimidoyl-N-(4-methylphenyl)sulfonylbut-2-enamide |
| SMILES | [H]/N=C/C(C(=O)NS(=O)(=O)c1ccc(C)cc1)=C(\O)C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O4S/c1-7-2-4-8(5-3-7)22(20,21)17-11(19)9(6-16)10(18)12(13,14)15/h2-6,16,18H,1H3,(H,17,19)/b10-9+,16-6+ |
| InChIKey | LQTUBUAUGQMCAL-YHKQKCCRSA-N |
| XLogP | 1.82 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|