C17H19N2O3S- — CID 51371490
N-(4-methylphenyl)sulfonyl-N'-[(2S)-1-phenylpropan-2-yl]carbamimidate (PubChem CID 51371490) has the molecular formula C17H19N2O3S- and a molecular weight of 331.42 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-N'-[(2S)-1-phenylpropan-2-yl]carbamimidate.
| Compound Name | N-(4-methylphenyl)sulfonyl-N'-[(2S)-1-phenylpropan-2-yl]carbamimidate |
|---|---|
| PubChem CID | 51371490 |
| Molecular Formula | C17H19N2O3S- |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-N'-[(2S)-1-phenylpropan-2-yl]carbamimidate |
| SMILES | Cc1ccc(S(=O)(=O)N/C([O-])=N/[C@@H](C)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N2O3S/c1-13-8-10-16(11-9-13)23(21,22)19-17(20)18-14(2)12-15-6-4-3-5-7-15/h3-11,14H,12H2,1-2H3,(H2,18,19,20)/p-1/t14-/m0/s1 |
| InChIKey | XILWEASNBDKGSA-AWEZNQCLSA-M |
| XLogP | 1.62 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|