C24H24N4O3S — CID 21203335
N-(3,4-dimethyl-2-phenyloxadiazol-5-yl)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide (PubChem CID 21203335) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-(3,4-dimethyl-2-phenyloxadiazol-5-yl)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide.
| Compound Name | N-(3,4-dimethyl-2-phenyloxadiazol-5-yl)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 21203335 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-(3,4-dimethyl-2-phenyloxadiazol-5-yl)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide |
| SMILES | CC1=C(NC(=NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)ON(c2ccccc2)N1C |
| InChI | InChI=1S/C24H24N4O3S/c1-18-14-16-22(17-15-18)32(29,30)26-23(20-10-6-4-7-11-20)25-24-19(2)27(3)28(31-24)21-12-8-5-9-13-21/h4-17H,1-3H3,(H,25,26) |
| InChIKey | NOCLJEDPZSYIQJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|