C27H23N5O2S2 — CID 4023336
1-[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]-3-(dianilinomethylidene)thiourea (PubChem CID 4023336) has the molecular formula C27H23N5O2S2 and a molecular weight of 513.65 g/mol. Its IUPAC name is 1-[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]-3-(dianilinomethylidene)thiourea.
| Compound Name | 1-[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]-3-(dianilinomethylidene)thiourea |
|---|---|
| PubChem CID | 4023336 |
| Molecular Formula | C27H23N5O2S2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 1-[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]-3-(dianilinomethylidene)thiourea |
| SMILES | O=S(=O)(N=C(NC(=S)N=C(Nc1ccccc1)Nc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H23N5O2S2/c33-36(34,24-19-11-4-12-20-24)32-25(21-13-5-1-6-14-21)30-27(35)31-26(28-22-15-7-2-8-16-22)29-23-17-9-3-10-18-23/h1-20H,(H3,28,29,30,31,32,35) |
| InChIKey | FDBMNDATSNOGCW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|