C20H17N3S — CID 2853502
1-[anilino(phenyl)methylidene]-3-phenylthiourea (PubChem CID 2853502) has the molecular formula C20H17N3S and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-[anilino(phenyl)methylidene]-3-phenylthiourea.
| Compound Name | 1-[anilino(phenyl)methylidene]-3-phenylthiourea |
|---|---|
| PubChem CID | 2853502 |
| Molecular Formula | C20H17N3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-[anilino(phenyl)methylidene]-3-phenylthiourea |
| SMILES | S=C(N=C(Nc1ccccc1)c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C20H17N3S/c24-20(22-18-14-8-3-9-15-18)23-19(16-10-4-1-5-11-16)21-17-12-6-2-7-13-17/h1-15H,(H2,21,22,23,24) |
| InChIKey | SRAXJVRQKOKBMO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|