C25H26N4 — CID 54284526
N-[anilino(phenyl)methylidene]-N'-phenylpiperidine-1-carboximidamide (PubChem CID 54284526) has the molecular formula C25H26N4 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[anilino(phenyl)methylidene]-N'-phenylpiperidine-1-carboximidamide.
| Compound Name | N-[anilino(phenyl)methylidene]-N'-phenylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 54284526 |
| Molecular Formula | C25H26N4 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | N-[anilino(phenyl)methylidene]-N'-phenylpiperidine-1-carboximidamide |
| SMILES | c1ccc(/N=C(/N=C(Nc2ccccc2)c2ccccc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H26N4/c1-5-13-21(14-6-1)24(26-22-15-7-2-8-16-22)28-25(29-19-11-4-12-20-29)27-23-17-9-3-10-18-23/h1-3,5-10,13-18H,4,11-12,19-20H2,(H,26,27,28) |
| InChIKey | RTDXSTHAGBPHIV-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|