C25H26N4 — CID 22388670
(NZ)-N-[anilino-(2-methylphenyl)methylidene]-N'-phenylpyrrolidine-1-carboximidamide (PubChem CID 22388670) has the molecular formula C25H26N4 and a molecular weight of 382.51 g/mol. Its IUPAC name is (NZ)-N-[anilino-(2-methylphenyl)methylidene]-N'-phenylpyrrolidine-1-carboximidamide.
| Compound Name | (NZ)-N-[anilino-(2-methylphenyl)methylidene]-N'-phenylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 22388670 |
| Molecular Formula | C25H26N4 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | (NZ)-N-[anilino-(2-methylphenyl)methylidene]-N'-phenylpyrrolidine-1-carboximidamide |
| SMILES | Cc1ccccc1/C(=N/C(=N/c1ccccc1)N1CCCC1)Nc1ccccc1 |
| InChI | InChI=1S/C25H26N4/c1-20-12-8-9-17-23(20)24(26-21-13-4-2-5-14-21)28-25(29-18-10-11-19-29)27-22-15-6-3-7-16-22/h2-9,12-17H,10-11,18-19H2,1H3,(H,26,27,28) |
| InChIKey | SLMWJRCKAGFSLD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|