C27H30N4O — CID 54036187
N-[(4-methoxyanilino)-phenylmethylidene]-N'-phenylazepane-1-carboximidamide (PubChem CID 54036187) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[(4-methoxyanilino)-phenylmethylidene]-N'-phenylazepane-1-carboximidamide.
| Compound Name | N-[(4-methoxyanilino)-phenylmethylidene]-N'-phenylazepane-1-carboximidamide |
|---|---|
| PubChem CID | 54036187 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-[(4-methoxyanilino)-phenylmethylidene]-N'-phenylazepane-1-carboximidamide |
| SMILES | COc1ccc(NC(=N/C(=N\c2ccccc2)N2CCCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H30N4O/c1-32-25-18-16-24(17-19-25)28-26(22-12-6-4-7-13-22)30-27(29-23-14-8-5-9-15-23)31-20-10-2-3-11-21-31/h4-9,12-19H,2-3,10-11,20-21H2,1H3,(H,28,29,30) |
| InChIKey | LJCPAIHDOQMBBT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|