C26H26F2N4O — CID 22388695
(NZ)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-N'-(4-fluorophenyl)oxazinane-2-carboximidamide (PubChem CID 22388695) has the molecular formula C26H26F2N4O and a molecular weight of 448.52 g/mol. Its IUPAC name is (NZ)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-N'-(4-fluorophenyl)oxazinane-2-carboximidamide.
| Compound Name | (NZ)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-N'-(4-fluorophenyl)oxazinane-2-carboximidamide |
|---|---|
| PubChem CID | 22388695 |
| Molecular Formula | C26H26F2N4O |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (NZ)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-N'-(4-fluorophenyl)oxazinane-2-carboximidamide |
| SMILES | Cc1cccc(C)c1/C(=N/C(=N/c1ccc(F)cc1)N1CCCCO1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H26F2N4O/c1-18-6-5-7-19(2)24(18)25(29-22-12-8-20(27)9-13-22)31-26(32-16-3-4-17-33-32)30-23-14-10-21(28)11-15-23/h5-15H,3-4,16-17H2,1-2H3,(H,29,30,31) |
| InChIKey | QOHPMFHDNRTXHP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|