C29H31F3N4O — CID 22388612
(NE)-N-[(2,6-dimethylphenyl)-[4-(trifluoromethoxy)anilino]methylidene]-2-methyl-N'-phenylpiperidine-1-carboximidamide (PubChem CID 22388612) has the molecular formula C29H31F3N4O and a molecular weight of 508.59 g/mol. Its IUPAC name is (NE)-N-[(2,6-dimethylphenyl)-[4-(trifluoromethoxy)anilino]methylidene]-2-methyl-N'-phenylpiperidine-1-carboximidamide.
| Compound Name | (NE)-N-[(2,6-dimethylphenyl)-[4-(trifluoromethoxy)anilino]methylidene]-2-methyl-N'-phenylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 22388612 |
| Molecular Formula | C29H31F3N4O |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (NE)-N-[(2,6-dimethylphenyl)-[4-(trifluoromethoxy)anilino]methylidene]-2-methyl-N'-phenylpiperidine-1-carboximidamide |
| SMILES | Cc1cccc(C)c1/C(=N\C(=N\c1ccccc1)N1CCCCC1C)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C29H31F3N4O/c1-20-10-9-11-21(2)26(20)27(33-24-15-17-25(18-16-24)37-29(30,31)32)35-28(34-23-13-5-4-6-14-23)36-19-8-7-12-22(36)3/h4-6,9-11,13-18,22H,7-8,12,19H2,1-3H3,(H,33,34,35) |
| InChIKey | YRHGAWKMNWPQFW-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|