C26H25F3N4 — CID 87976890
(NZ)-N-[(2,6-difluorophenyl)-(4-fluoroanilino)methylidene]-N'-phenylazepane-1-carboximidamide (PubChem CID 87976890) has the molecular formula C26H25F3N4 and a molecular weight of 450.51 g/mol. Its IUPAC name is (NZ)-N-[(2,6-difluorophenyl)-(4-fluoroanilino)methylidene]-N'-phenylazepane-1-carboximidamide.
| Compound Name | (NZ)-N-[(2,6-difluorophenyl)-(4-fluoroanilino)methylidene]-N'-phenylazepane-1-carboximidamide |
|---|---|
| PubChem CID | 87976890 |
| Molecular Formula | C26H25F3N4 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | (NZ)-N-[(2,6-difluorophenyl)-(4-fluoroanilino)methylidene]-N'-phenylazepane-1-carboximidamide |
| SMILES | Fc1ccc(N/C(=N\C(=N/c2ccccc2)N2CCCCCC2)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C26H25F3N4/c27-19-13-15-21(16-14-19)30-25(24-22(28)11-8-12-23(24)29)32-26(31-20-9-4-3-5-10-20)33-17-6-1-2-7-18-33/h3-5,8-16H,1-2,6-7,17-18H2,(H,30,31,32) |
| InChIKey | LQFSQLYECZJNBE-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|