C28H30F2N4 — CID 22388606
(NZ)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-N'-(4-fluorophenyl)-2-methylpiperidine-1-carboximidamide (PubChem CID 22388606) has the molecular formula C28H30F2N4 and a molecular weight of 460.57 g/mol. Its IUPAC name is (NZ)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-N'-(4-fluorophenyl)-2-methylpiperidine-1-carboximidamide.
| Compound Name | (NZ)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-N'-(4-fluorophenyl)-2-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 22388606 |
| Molecular Formula | C28H30F2N4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (NZ)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-N'-(4-fluorophenyl)-2-methylpiperidine-1-carboximidamide |
| SMILES | Cc1cccc(C)c1/C(=N/C(=N/c1ccc(F)cc1)N1CCCCC1C)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C28H30F2N4/c1-19-7-6-8-20(2)26(19)27(31-24-14-10-22(29)11-15-24)33-28(34-18-5-4-9-21(34)3)32-25-16-12-23(30)13-17-25/h6-8,10-17,21H,4-5,9,18H2,1-3H3,(H,31,32,33) |
| InChIKey | VGLDVVGYLUKBMS-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|