C28H30ClFN4 — CID 54421533
N'-(2-chlorophenyl)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-2-methylpiperidine-1-carboximidamide (PubChem CID 54421533) has the molecular formula C28H30ClFN4 and a molecular weight of 477.03 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-2-methylpiperidine-1-carboximidamide.
| Compound Name | N'-(2-chlorophenyl)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-2-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 54421533 |
| Molecular Formula | C28H30ClFN4 |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N'-(2-chlorophenyl)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-2-methylpiperidine-1-carboximidamide |
| SMILES | Cc1cccc(C)c1C(=N/C(=N/c1ccccc1Cl)N1CCCCC1C)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C28H30ClFN4/c1-19-9-8-10-20(2)26(19)27(31-23-16-14-22(30)15-17-23)33-28(34-18-7-6-11-21(34)3)32-25-13-5-4-12-24(25)29/h4-5,8-10,12-17,21H,6-7,11,18H2,1-3H3,(H,31,32,33) |
| InChIKey | WBDVXLYXRKATEH-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|