C28H32FN5 — CID 22388621
(NE)-N'-(4-aminophenyl)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-2-methylpiperidine-1-carboximidamide (PubChem CID 22388621) has the molecular formula C28H32FN5 and a molecular weight of 457.60 g/mol. Its IUPAC name is (NE)-N'-(4-aminophenyl)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-2-methylpiperidine-1-carboximidamide.
| Compound Name | (NE)-N'-(4-aminophenyl)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-2-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 22388621 |
| Molecular Formula | C28H32FN5 |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | (NE)-N'-(4-aminophenyl)-N-[(2,6-dimethylphenyl)-(4-fluoroanilino)methylidene]-2-methylpiperidine-1-carboximidamide |
| SMILES | Cc1cccc(C)c1/C(=N\C(=N\c1ccc(N)cc1)N1CCCCC1C)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C28H32FN5/c1-19-7-6-8-20(2)26(19)27(31-24-14-10-22(29)11-15-24)33-28(34-18-5-4-9-21(34)3)32-25-16-12-23(30)13-17-25/h6-8,10-17,21H,4-5,9,18,30H2,1-3H3,(H,31,32,33) |
| InChIKey | ABULFGWXPKGNEP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|