C19H29FN4 — CID 134091927
N'-[(1S,2S)-2-aminocyclohexyl]-N-(3-fluorophenyl)-2-methylpiperidine-1-carboximidamide (PubChem CID 134091927) has the molecular formula C19H29FN4 and a molecular weight of 332.47 g/mol. Its IUPAC name is N'-[(1S,2S)-2-aminocyclohexyl]-N-(3-fluorophenyl)-2-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[(1S,2S)-2-aminocyclohexyl]-N-(3-fluorophenyl)-2-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 134091927 |
| Molecular Formula | C19H29FN4 |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | N'-[(1S,2S)-2-aminocyclohexyl]-N-(3-fluorophenyl)-2-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCCN1/C(=N/[C@H]1CCCC[C@@H]1N)Nc1cccc(F)c1 |
| InChI | InChI=1S/C19H29FN4/c1-14-7-4-5-12-24(14)19(22-16-9-6-8-15(20)13-16)23-18-11-3-2-10-17(18)21/h6,8-9,13-14,17-18H,2-5,7,10-12,21H2,1H3,(H,22,23)/t14?,17-,18-/m0/s1 |
| InChIKey | XFWBXWATQNXNJR-UNWPMLMHSA-N |
| XLogP | 3.74 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|