C15H21FN2O2 — CID 95628326
(2R)-N-(3-fluorophenyl)-2-[(1R)-1-hydroxypropyl]piperidine-1-carboxamide (PubChem CID 95628326) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is (2R)-N-(3-fluorophenyl)-2-[(1R)-1-hydroxypropyl]piperidine-1-carboxamide.
| Compound Name | (2R)-N-(3-fluorophenyl)-2-[(1R)-1-hydroxypropyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95628326 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (2R)-N-(3-fluorophenyl)-2-[(1R)-1-hydroxypropyl]piperidine-1-carboxamide |
| SMILES | CC[C@@H](O)[C@H]1CCCCN1C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H21FN2O2/c1-2-14(19)13-8-3-4-9-18(13)15(20)17-12-7-5-6-11(16)10-12/h5-7,10,13-14,19H,2-4,8-9H2,1H3,(H,17,20)/t13-,14-/m1/s1 |
| InChIKey | FUEIJBXVCYSOHT-ZIAGYGMSSA-N |
| XLogP | 2.98 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |