C20H31FN4 — CID 134091911
2-[(1S,2S)-2-aminocyclohexyl]-1-cycloheptyl-3-(3-fluorophenyl)guanidine (PubChem CID 134091911) has the molecular formula C20H31FN4 and a molecular weight of 346.49 g/mol. Its IUPAC name is 2-[(1S,2S)-2-aminocyclohexyl]-1-cycloheptyl-3-(3-fluorophenyl)guanidine.
| Compound Name | 2-[(1S,2S)-2-aminocyclohexyl]-1-cycloheptyl-3-(3-fluorophenyl)guanidine |
|---|---|
| PubChem CID | 134091911 |
| Molecular Formula | C20H31FN4 |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2-[(1S,2S)-2-aminocyclohexyl]-1-cycloheptyl-3-(3-fluorophenyl)guanidine |
| SMILES | N[C@H]1CCCC[C@@H]1/N=C(\Nc1cccc(F)c1)NC1CCCCCC1 |
| InChI | InChI=1S/C20H31FN4/c21-15-8-7-11-17(14-15)24-20(23-16-9-3-1-2-4-10-16)25-19-13-6-5-12-18(19)22/h7-8,11,14,16,18-19H,1-6,9-10,12-13,22H2,(H2,23,24,25)/t18-,19-/m0/s1 |
| InChIKey | XQGIVOVKGQBORE-OALUTQOASA-N |
| XLogP | 4.18 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|