C13H18ClFN4O — CID 142736013
2-(2-aminocyclohexyl)-1-(3-chloro-4-fluorophenyl)-3-hydroxyguanidine (PubChem CID 142736013) has the molecular formula C13H18ClFN4O and a molecular weight of 300.77 g/mol. Its IUPAC name is 2-(2-aminocyclohexyl)-1-(3-chloro-4-fluorophenyl)-3-hydroxyguanidine.
| Compound Name | 2-(2-aminocyclohexyl)-1-(3-chloro-4-fluorophenyl)-3-hydroxyguanidine |
|---|---|
| PubChem CID | 142736013 |
| Molecular Formula | C13H18ClFN4O |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-(2-aminocyclohexyl)-1-(3-chloro-4-fluorophenyl)-3-hydroxyguanidine |
| SMILES | NC1CCCCC1/N=C(\NO)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClFN4O/c14-9-7-8(5-6-10(9)15)17-13(19-20)18-12-4-2-1-3-11(12)16/h5-7,11-12,20H,1-4,16H2,(H2,17,18,19) |
| InChIKey | WFTHZTOWFJFBHS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|