C18H26N4O — CID 134091864
1-(3-acetylphenyl)-2-[(1S,2S)-2-aminocyclohexyl]-3-cyclopropylguanidine (PubChem CID 134091864) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-2-[(1S,2S)-2-aminocyclohexyl]-3-cyclopropylguanidine.
| Compound Name | 1-(3-acetylphenyl)-2-[(1S,2S)-2-aminocyclohexyl]-3-cyclopropylguanidine |
|---|---|
| PubChem CID | 134091864 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 1-(3-acetylphenyl)-2-[(1S,2S)-2-aminocyclohexyl]-3-cyclopropylguanidine |
| SMILES | CC(=O)c1cccc(N/C(=N/[C@H]2CCCC[C@@H]2N)NC2CC2)c1 |
| InChI | InChI=1S/C18H26N4O/c1-12(23)13-5-4-6-15(11-13)21-18(20-14-9-10-14)22-17-8-3-2-7-16(17)19/h4-6,11,14,16-17H,2-3,7-10,19H2,1H3,(H2,20,21,22)/t16-,17-/m0/s1 |
| InChIKey | BXGPXSLXPFGSMK-IRXDYDNUSA-N |
| XLogP | 2.68 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|