C23H30N4O2 — CID 134091863
1-(3-acetylphenyl)-3-[(1S,2S)-2-aminocyclohexyl]-2-[2-(4-hydroxyphenyl)ethyl]guanidine (PubChem CID 134091863) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[(1S,2S)-2-aminocyclohexyl]-2-[2-(4-hydroxyphenyl)ethyl]guanidine.
| Compound Name | 1-(3-acetylphenyl)-3-[(1S,2S)-2-aminocyclohexyl]-2-[2-(4-hydroxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 134091863 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[(1S,2S)-2-aminocyclohexyl]-2-[2-(4-hydroxyphenyl)ethyl]guanidine |
| SMILES | CC(=O)c1cccc(N/C(=N\CCc2ccc(O)cc2)N[C@H]2CCCC[C@@H]2N)c1 |
| InChI | InChI=1S/C23H30N4O2/c1-16(28)18-5-4-6-19(15-18)26-23(27-22-8-3-2-7-21(22)24)25-14-13-17-9-11-20(29)12-10-17/h4-6,9-12,15,21-22,29H,2-3,7-8,13-14,24H2,1H3,(H2,25,26,27)/t21-,22-/m0/s1 |
| InChIKey | HSSHVNFEYOAUJA-VXKWHMMOSA-N |
| XLogP | 3.46 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|