C21H33N3O — CID 134121687
2-(cyclohexylmethyl)-1-(3-hydroxyphenyl)-3-(2-methylcyclohexyl)guanidine (PubChem CID 134121687) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-1-(3-hydroxyphenyl)-3-(2-methylcyclohexyl)guanidine.
| Compound Name | 2-(cyclohexylmethyl)-1-(3-hydroxyphenyl)-3-(2-methylcyclohexyl)guanidine |
|---|---|
| PubChem CID | 134121687 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | 2-(cyclohexylmethyl)-1-(3-hydroxyphenyl)-3-(2-methylcyclohexyl)guanidine |
| SMILES | CC1CCCCC1N/C(=N\CC1CCCCC1)Nc1cccc(O)c1 |
| InChI | InChI=1S/C21H33N3O/c1-16-8-5-6-13-20(16)24-21(22-15-17-9-3-2-4-10-17)23-18-11-7-12-19(25)14-18/h7,11-12,14,16-17,20,25H,2-6,8-10,13,15H2,1H3,(H2,22,23,24) |
| InChIKey | XBQUMWHJDVFXQT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|