C20H31FN4 — CID 134091938
2-[[3-(aminomethyl)cyclohexyl]methyl]-1-cyclopentyl-3-(3-fluorophenyl)guanidine (PubChem CID 134091938) has the molecular formula C20H31FN4 and a molecular weight of 346.49 g/mol. Its IUPAC name is 2-[[3-(aminomethyl)cyclohexyl]methyl]-1-cyclopentyl-3-(3-fluorophenyl)guanidine.
| Compound Name | 2-[[3-(aminomethyl)cyclohexyl]methyl]-1-cyclopentyl-3-(3-fluorophenyl)guanidine |
|---|---|
| PubChem CID | 134091938 |
| Molecular Formula | C20H31FN4 |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2-[[3-(aminomethyl)cyclohexyl]methyl]-1-cyclopentyl-3-(3-fluorophenyl)guanidine |
| SMILES | NCC1CCCC(C/N=C(/Nc2cccc(F)c2)NC2CCCC2)C1 |
| InChI | InChI=1S/C20H31FN4/c21-17-7-4-10-19(12-17)25-20(24-18-8-1-2-9-18)23-14-16-6-3-5-15(11-16)13-22/h4,7,10,12,15-16,18H,1-3,5-6,8-9,11,13-14,22H2,(H2,23,24,25) |
| InChIKey | OFSDRJURGRGBBB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|