C26H40N4O — CID 134091845
N-(3-acetylphenyl)-N'-[[3-(aminomethyl)cyclohexyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide (PubChem CID 134091845) has the molecular formula C26H40N4O and a molecular weight of 424.63 g/mol. Its IUPAC name is N-(3-acetylphenyl)-N'-[[3-(aminomethyl)cyclohexyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide.
| Compound Name | N-(3-acetylphenyl)-N'-[[3-(aminomethyl)cyclohexyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide |
|---|---|
| PubChem CID | 134091845 |
| Molecular Formula | C26H40N4O |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | N-(3-acetylphenyl)-N'-[[3-(aminomethyl)cyclohexyl]methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboximidamide |
| SMILES | CC(=O)c1cccc(N/C(=N\CC2CCCC(CN)C2)N2CCCC3CCCCC32)c1 |
| InChI | InChI=1S/C26H40N4O/c1-19(31)23-10-5-12-24(16-23)29-26(28-18-21-8-4-7-20(15-21)17-27)30-14-6-11-22-9-2-3-13-25(22)30/h5,10,12,16,20-22,25H,2-4,6-9,11,13-15,17-18,27H2,1H3,(H,28,29) |
| InChIKey | RALNBTRVMBDBTM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|