C22H30N4OS — CID 134091835
1-(3-acetylphenyl)-3-[[3-(aminomethyl)cyclohexyl]methyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 134091835) has the molecular formula C22H30N4OS and a molecular weight of 398.58 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[[3-(aminomethyl)cyclohexyl]methyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-(3-acetylphenyl)-3-[[3-(aminomethyl)cyclohexyl]methyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 134091835 |
| Molecular Formula | C22H30N4OS |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[[3-(aminomethyl)cyclohexyl]methyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CC(=O)c1cccc(N/C(=N/Cc2cccs2)NCC2CCCC(CN)C2)c1 |
| InChI | InChI=1S/C22H30N4OS/c1-16(27)19-7-3-8-20(12-19)26-22(25-15-21-9-4-10-28-21)24-14-18-6-2-5-17(11-18)13-23/h3-4,7-10,12,17-18H,2,5-6,11,13-15,23H2,1H3,(H2,24,25,26) |
| InChIKey | CXIZHNGDHPKCER-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|