C20H26N4O2S — CID 111259071
N-[3-[[[ethylamino-(thiophen-2-ylmethylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide (PubChem CID 111259071) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[3-[[[ethylamino-(thiophen-2-ylmethylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[[ethylamino-(thiophen-2-ylmethylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 111259071 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[3-[[[ethylamino-(thiophen-2-ylmethylamino)methylidene]amino]methyl]phenyl]oxolane-2-carboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCCO2)c1)NCc1cccs1 |
| InChI | InChI=1S/C20H26N4O2S/c1-2-21-20(23-14-17-8-5-11-27-17)22-13-15-6-3-7-16(12-15)24-19(25)18-9-4-10-26-18/h3,5-8,11-12,18H,2,4,9-10,13-14H2,1H3,(H,24,25)(H2,21,22,23) |
| InChIKey | ZYDFWGBPLXRAIA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|