C21H29IN4O2S — CID 111898990
N-[3-[[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide (PubChem CID 111898990) has the molecular formula C21H29IN4O2S and a molecular weight of 528.46 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111898990 |
| Molecular Formula | C21H29IN4O2S |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | N-[3-[[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCCO2)c1)NCc1ccc(C)s1.I |
| InChI | InChI=1S/C21H28N4O2S.HI/c1-3-22-21(24-14-18-10-9-15(2)28-18)23-13-16-6-4-7-17(12-16)25-20(26)19-8-5-11-27-19;/h4,6-7,9-10,12,19H,3,5,8,11,13-14H2,1-2H3,(H,25,26)(H2,22,23,24);1H |
| InChIKey | SBEGMVIGIMHCMA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|