C23H30N4O3 — CID 111250637
N-[3-[[[ethylamino-[(3-methoxyphenyl)methylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide (PubChem CID 111250637) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(3-methoxyphenyl)methylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[[ethylamino-[(3-methoxyphenyl)methylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 111250637 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | N-[3-[[[ethylamino-[(3-methoxyphenyl)methylamino]methylidene]amino]methyl]phenyl]oxolane-2-carboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCCO2)c1)NCc1cccc(OC)c1 |
| InChI | InChI=1S/C23H30N4O3/c1-3-24-23(26-16-18-8-5-10-20(14-18)29-2)25-15-17-7-4-9-19(13-17)27-22(28)21-11-6-12-30-21/h4-5,7-10,13-14,21H,3,6,11-12,15-16H2,1-2H3,(H,27,28)(H2,24,25,26) |
| InChIKey | QDSHMQRKJDULJE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|