C24H32N4O2 — CID 111250181
N-[3-[[[ethylamino-[(3-methoxyphenyl)methylamino]methylidene]amino]methyl]phenyl]cyclopentanecarboxamide (PubChem CID 111250181) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(3-methoxyphenyl)methylamino]methylidene]amino]methyl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[[[ethylamino-[(3-methoxyphenyl)methylamino]methylidene]amino]methyl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 111250181 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | N-[3-[[[ethylamino-[(3-methoxyphenyl)methylamino]methylidene]amino]methyl]phenyl]cyclopentanecarboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C2CCCC2)c1)NCc1cccc(OC)c1 |
| InChI | InChI=1S/C24H32N4O2/c1-3-25-24(27-17-19-9-7-13-22(15-19)30-2)26-16-18-8-6-12-21(14-18)28-23(29)20-10-4-5-11-20/h6-9,12-15,20H,3-5,10-11,16-17H2,1-2H3,(H,28,29)(H2,25,26,27) |
| InChIKey | IHGHCUZFOPBCOK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|